| Identification |
| Name: | 2,4,7-trinitro-9H-fluoren-9-one - 2-methyltetraphene (1:1) |
| Synonyms: | NSC408189;AC1L8A38;NSC-408189;2-methylbenzo[a]anthracene; 2,4,7-trinitrofluoren-9-one;7509-82-2 |
| CAS: | 7509-82-2 |
| Molecular Formula: | C32H19N3O7 |
| Molecular Weight: | 557.5092 |
| InChI: | InChI=1/C19H14.C13H5N3O7/c1-13-6-7-14-8-9-17-11-15-4-2-3-5-16(15)12-19(17)18(14)10-13;17-13-9-3-6(14(18)19)1-2-8(9)12-10(13)4-7(15(20)21)5-11(12)16(22)23/h2-12H,1H3;1-5H |
| Molecular Structure: |
![(C32H19N3O7) NSC408189;AC1L8A38;NSC-408189;2-methylbenzo[a]anthracene; 2,4,7-trinitrofluoren-9-one;7509-82-2](https://img.guidechem.com/pic/image/7509-82-2.png) |
| Properties |
| Flash Point: | 292.3°C |
| Boiling Point: | 561.7°C at 760 mmHg |
| Flash Point: | 292.3°C |
| Safety Data |
| |
 |