| Identification | |
| Name: | Quinoline,7-bromo-4-chloro- |
| Synonyms: | 7-Bromo-4-chloroquinoline; |
| CAS: | 75090-52-7 |
| Molecular Formula: | C9H5BrClN |
| Molecular Weight: | 242.5 |
| InChI: | InChI=1/C9H5BrClN/c10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.673 g/cm3 |
| Refractive index: | 1.68 |
| Specification: |
The 7-Bromo-4-chloroquinoline with the CAS number 75090-52-7 is also called Quinoline,7-bromo-4-chloro-. Its molecular formula is C9H5BrClN. The product category is Chiral Chemicals. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the 7-Bromo-4-chloroquinoline are: (1)ACD/LogP: 4.65; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 4; (4)ACD/LogD (pH 7.4): 4; (5)ACD/BCF (pH 5.5): 329; (6)ACD/BCF (pH 7.4): 329; (7)ACD/KOC (pH 5.5): 2205; (8)ACD/KOC (pH 7.4): 2206; (9)#H bond acceptors: 1; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 12.89 Å2; (13)Index of Refraction: 1.68; (14)Molar Refractivity: 54.772 cm3; (15)Molar Volume: 144.909 cm3; (16)Polarizability: 21.713×10-24cm3; (17)Surface Tension: 53.343 dyne/cm; (18)Enthalpy of Vaporization: 53.361 kJ/mol; (19)Vapour Pressure: 0.001 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
