| Identification | |
| Name: | D-Glucose, 2-(acetylamino)-2-deoxy- |
| CAS: | 7512-17-6 |
| EINECS: | 231-368-2 |
| Molecular Formula: | C8H15NO6 |
| Molecular Weight: | 221.21 |
| InChI: | InChI=1S/C8H15NO6/c1-4(12)9-5(2-10)7(14)8(15)6(13)3-11/h2,5-8,11,13-15H,3H2,1H3,(H,9,12) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Melting Point: | 195 - 205 C |
| Density: | 1.5 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Alpha: | 42 o (C=2,WATER,2 HRS) |
| Water Solubility: | soluble |
| Solubility: | soluble Appearance:white crystalline powder Transport Information:25kgs Hazard Symbols:not regulated UN NO. particular:particular |
| Appearance: | white crystalline powder |
| Specification: | White powder usageEng:A pharmaceutical and cosmetic compound. Safety Statements:24/25-36-26 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29329985 |
| Sensitive: | Hygroscopic |
| Color: | white to off-white |
| Usage: | A pharmaceutical and cosmetic compound. |
| Safety Data | |
| Hazard Symbols | |
 |
|
