| Identification | |
| Name: | 5-Pyrimidinamine,4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-6-methoxy-2-methyl- |
| Synonyms: | 2-(6-Chloro-4-methoxy-2-methylpyrimidin-5-ylamino)-2-imidazoline;BDF 5895;BE 5895;Cynt;LY 326869;Lomox;Moxon;Moxonidine;Norcynt;Normoxocin;Nucynt;Physiotens; |
| CAS: | 75438-57-2 |
| Molecular Formula: | C9H12ClN5O |
| Molecular Weight: | 241.68 |
| InChI: | InChI=1/C9H12ClN5O/c1-5-13-7(10)6(8(14-5)16-2)15-9-11-3-4-12-9/h3-4H2,1-2H3,(H2,11,12,15) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 174.3°C |
| Boiling Point: | 364.7°C at 760 mmHg |
| Density: | 1.52 g/cm3 (20 C) |
| Refractive index: | 1.68 |
| Solubility: | Soluble |
| Appearance: | crystal |
| Specification: |
Cautions:?Moxonidine (CAS NO.75438-57-2)?should not be used for treatment in?patients with moderate to severe renal impairment. Abrupt discontinuation of the drug should also be avoided. If concomitant treatment with a beta blocker has to be stopped, the beta blocker should be discontinued first, then moxonidine after a few days. ? Drug interactions: It?is not indicated that concomitant administration of moxonidine and a thiazide diuretic such as hydrochlorothiazide, as both drugs' hypotensive effects may be enhanced. Side-effects: Noteworthy side effects?are as follows:?dry mouth, headache, fatigue, dizziness, nausea, sleep disturbances (rarely sedation), asthenia, vasodilatation, and rarely, skin reactions. |
| Flash Point: | 174.3°C |
| Storage Temperature: | Store in original container in a cool dark place. |
| Usage: | Antihypertensive,. |
| Safety Data | |
 |
|
