| Identification |
| Name: | Propanamide,N,N-dimethyl- |
| Synonyms: | Propionamide,N,N-dimethyl- (6CI,7CI,8CI);DMP; |
| CAS: | 758-96-3 |
| EINECS: | 212-064-9 |
| Molecular Formula: | C5H11NO |
| Molecular Weight: | 101.15 |
| InChI: | InChI=1/C5H11NO/c1-4-5(7)6(2)3/h4H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.93 |
| Stability: | Flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.438-1.442 |
| Water Solubility: | SOLUBLE |
| Solubility: | SOLUBLE |
| Appearance: | Coloress Clear Liquid |
| HS Code: | 29241900 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
