| Identification | |
| Name: | Acetamide,N,N-bis(1-methylethyl)- |
| Synonyms: | Acetamide,N,N-diisopropyl- (7CI,8CI); N,N-Diisopropylacetamide;N,N'-Bis(1-methylethyl)acetamide; N-Acetyldiisopropylamine; NSC 6006 |
| CAS: | 759-22-8 |
| Molecular Formula: | C8H17 N O |
| Molecular Weight: | 143.23 |
| InChI: | InChI=1/C8H17NO/c1-6(2)9(7(3)4)8(5)10/h6-7H,1-5H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 172 °F |
| Boiling Point: | 196 °C(lit.) |
| Density: | 0.891 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.441(lit.) |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 172 °F |
| Safety Data | |
 |
|
