Identification |
Name: | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one,2',7'-dichloro-3',6'-dihydroxy- |
Synonyms: | Fluorescein,2',7'-dichloro- (6CI,7CI,8CI);D and C Orange 25;Dand C Orange No. 25;Fluorescein 27;Fluorescein 548; |
CAS: | 76-54-0 |
EINECS: | 200-968-6 |
Molecular Formula: | C20H10Cl2O5 |
Molecular Weight: | 401.1964 |
InChI: | InChI=1S/C20H10Cl2O5/c21-13-5-11-17(7-15(13)23)26-18-8-16(24)14(22)6-12(18)20(11)10-4-2-1-3-9(10)19(25)27-20/h1-8,23-24H |
Molecular Structure: |
|
Properties |
Transport: | UN 1219 3 |
Stability: | Stable. Incompatible with strong oxidizing agents. |
Refractive index: | 1.757 |
Water Solubility: | Insoluble in water. |
Solubility: | Insoluble in water. |
Appearance: | orange-yellow Solid |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
|