| Identification | |
| Name: | Diethyl phosphite |
| Synonyms: | Ethylphosphite, (EtO)2(HO)P (6CI);Diethoxyphosphine oxide;Diethyl acid phosphite;Diethyl hydrogen phosphite;Phosphonic acid,diethyl ester;Diethyl phosphonate;Hydrogendiethyl phosphite;NSC 2665;Diethyl phosphonate;Ethyl phosphonate;phosphonic acid, diethyl ester; |
| CAS: | 762-04-9 |
| EINECS: | 212-091-6 |
| Molecular Formula: | C4H11O3P |
| Molecular Weight: | 138.1 |
| InChI: | InChI=1/C4H11O3P/c1-3-6-8(5)7-4-2/h5H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.072 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong acids, acid chlorides, strong bases. May decompose on exposure to moisture. Combustible. |
| Refractive index: | 1.407-1.409 |
| Water Solubility: | miscible (hydrolysis) |
| Solubility: | miscible (hydrolysis) |
| Appearance: | colourless liquid |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Sensitive: | Moisture Sensitive |
| Color: | Water-white liquid |
| Usage: | Textile finishing agent, antioxidant, additive for adhesives & for extreme pressure lubricant, chemical intermediate for organic phosphorus compounds. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
