| Identification | |
| Name: | Hexanedioic acid,2-amino-, (2R)- |
| Synonyms: | Hexanedioicacid, 2-amino-, (R)-;Hexanedioic acid, 2-amino-, (R)-(-)- (8CI);(R)-2-Aminoadipic acid;D-(-)-2-Aminohexanedioic acid;D-2-Aminoadipic acid;D-Aminoadipic acid;D-a-Aminoadipic acid;(2R)-2-aminohexanedioic acid; |
| CAS: | 7620-28-2 |
| Molecular Formula: | C6H11NO4 |
| Molecular Weight: | 161.15584 |
| InChI: | InChI=1S/C6H11NO4/c7-4(6(10)11)2-1-3-5(8)9/h4H,1-3,7H2,(H,8,9)(H,10,11)/t4-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.333 g/cm3 |
| Alpha: | -24 o (C=1, 6N HCL) |
| Water Solubility: | Soluble in water |
| Solubility: | Soluble in water |
| Appearance: | white crystalline powder |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Storage Temperature: | Store at RT. |
| Safety Data | |
 |
|
