| Identification | |
| Name: | 1,3-Octadecanediol,2-amino-, (2S,3R)- |
| Synonyms: | 1,3-Octadecanediol,2-amino-, D-erythro- (8CI); 1,3-Octadecanediol, 2-amino-, [R-(R*,S*)]-;C18-Dihydrosphingosine; C18-Sphingosine, dihydro-;D-erythro-1,3-Dihydroxy-2-aminooctadecane;D-erythro-2-Amino-1,3-octadecanediol; D-erythro-C18-Dihydrosphingosine;D-erythro-Sphinganine; Dihydro-C18-sphingosine; Dihydrosphingosine;Octadecasphinganine; SPC 102860; Sphinganine; erythro-Sphinganine |
| CAS: | 764-22-7 |
| EINECS: | 212-116-0 |
| Molecular Formula: | C18H39 N O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C18H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(19)16-20/h17-18,20-21H,2-16,19H2,1H3 |
| Molecular Structure: | ![(C18H39NO2) 1,3-Octadecanediol,2-amino-, D-erythro- (8CI); 1,3-Octadecanediol, 2-amino-, [R-(R*,S*)]-;C18-Dihydr...](https://img1.guidechem.com/chem/e/dict/31/764-22-7.jpg) |
| Properties | |
| Flash Point: | 223.7°C |
| Boiling Point: | 446.2°C at 760 mmHg |
| Density: | 0.927g/cm3 |
| Refractive index: | 1.477 |
| Specification: | White Powder usageEng:Biosynthetic precursor of Sphingosine. Inhibits protein kinase C. |
| Flash Point: | 223.7°C |
| Usage: | Biosynthetic precursor of Sphingosine. Inhibits protein kinase C. |
| Safety Data | |
 |
|
