| Identification | |
| Name: | 10H-Phenothiazine,2-(methylthio)- |
| Synonyms: | Phenothiazine,2-(methylthio)- (6CI,7CI,8CI);2-(Methylthio)phenothiazine;2-Methylthio-10H-phenothiazine;3-(Methylthio)phenothiazine; |
| CAS: | 7643-08-5 |
| EINECS: | 231-581-0 |
| Molecular Formula: | C13H11NS2 |
| Molecular Weight: | 245.36 |
| InChI: | InChI=1/C13H11NS2/c1-15-9-6-7-13-11(8-9)14-10-4-2-3-5-12(10)16-13/h2-8,14H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 208.4°C |
| Boiling Point: | 421°C at 760 mmHg |
| Density: | 1.34g/cm3 |
| Refractive index: | 1.741 |
| Specification: |
10H-Phenothiazine,2-(methylthio)- , with CAS number of 7643-08-5, can be called 2-(methylthio)-10h-phenothiazin ; 2-methylmercapto phenothiazine ; 2-methylsulfanyl-10h-phenothiazine ; 2-methylthiophenothiazine . |
| Flash Point: | 208.4°C |
| Storage Temperature: | Refrigerator |
| Usage: | Phenothiazine derivative. |
| Safety Data | |
 |
|
