Identification |
Name: | Benzene,1-chloro-2-methoxy- |
Synonyms: | Anisole,o-chloro- (6CI,7CI,8CI);1-Chloro-2-methoxybenzene;2-Chloromethoxybenzene;2-Chlorophenol methyl ether;2-Methoxy-1-chlorobenzene;2-Methoxyphenyl chloride;NSC 155175;o-Chloroanisole;o-Chloromethoxybenzene;o-Chlorophenyl methyl ether;o-Methoxychlorobenzene; |
CAS: | 766-51-8 |
EINECS: | 212-167-9 |
Molecular Formula: | C7H7ClO |
Molecular Weight: | 142.58 |
InChI: | InChI=1/C7H7ClO/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3 |
Molecular Structure: |
|
Properties |
Melting Point: | -27 |
Density: | 1.123 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.5435-1.5455 |
Appearance: | clear slightly yellow liquid |
Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
|
|