| Identification | |
| Name: | 1-bromo-4-ethynylbenzene |
| Synonyms: | (4-Bromophenyl)acetylene; 4-Bromophenylacetylene |
| CAS: | 766-96-1 |
| EINECS: | -0 |
| Molecular Formula: | C8H5Br |
| Molecular Weight: | 181.03 |
| InChI: | InChI=1/C8H5Br/c1-2-7-3-5-8(9)6-4-7/h1,3-6H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 |
| Density: | 1.5 g/cm3 |
| Refractive index: | 1.604 |
| Appearance: | off-white solid |
| Specification: | Off-White Solid usageEng:Starting material for heterocyclotriynes, second-order nonlinear optical materials, and unsymmetrical 1,4-diarylbutadiynes Safety Statements:61 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Storage Temperature: | -20?C Freezer |
| Usage: | Starting material for heterocyclotriynes, second-order nonlinear optical materials, and unsymmetrical 1,4-diarylbutadiynes |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
N:Dangerousfortheenvironment
|
 |
|
