| Identification |
| Name: | 2-Pyrrolidinone,1-(3-aminopropyl)- |
| Synonyms: | 1-(3-Aminopropyl)-2-oxopyrrolidine;1-(3-Aminopropyl)-2-pyrrolidinone; 1-(3-Aminopropyl)-2-pyrrolidone;1-(3-Aminopropyl)pyrrolidin-2-one; 3-(2-Oxo-1-pyrrolidinyl)propylamine;Acisoga; N-(3-Aminopropyl)-2-pyrrolidinone; N-(3-Aminopropyl)-2-pyrrolidone;N-(3-Aminopropyl)-g-butyrolactam; NSC 108683; [3-(2-Oxopyrrolidino)propyl]amine |
| CAS: | 7663-77-6 |
| EINECS: | 231-632-7 |
| Molecular Formula: | C7H14 N2 O |
| Molecular Weight: |
142.20 |
| InChI: | InChI=1/C7H14N2O/c8-4-2-6-9-5-1-3-7(9)10/h1-6,8H2/p+1 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3267 |
| Flash Point: | 132.4°C |
| Boiling Point: | 312°Cat760mmHg |
| Density: | 1.06g/cm3 |
| Refractive index: | 1.5 |
| Specification: | Clear Slightly Yellowish Liquid usageEng:A useful synthetic intermediate. Safety Statements:26-27-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) |
| Flash Point: | 132.4°C |
| Storage Temperature: | Refrigerator |
| Usage: |
1-(3-Aminopropyl)-2-pyrrolidinone (CAS NO.7663-77-6) is used as synthetic intermediate.
|
| Safety Data |
| |
 |