| Identification | |
| Name: | N-Isopropylaniline |
| Synonyms: | N-Phenylisopropylamine |
| CAS: | 768-52-5 |
| EINECS: | 212-196-7 |
| Molecular Formula: | C9H13N |
| Molecular Weight: | 135.21 |
| InChI: | InChI=1/C9H13N/c1-8(2)10-9-6-4-3-5-7-9/h3-8,10H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Melting Point: | -32 C |
| Density: | 0.934 |
| Stability: | No data. |
| Refractive index: | 1.539 |
| Water Solubility: | < 0.01 (g/100 ml) |
| Solubility: | < 0.01 (g/100 ml) |
| Appearance: | clear to yellow liquid |
| Specification: |
Reactivity Profile: N-Isopropylaniline neutralizes acids in exothermic reactions to form salts plus water. May be incompatible with isocyanates, halogenated organics, peroxides, phenols (acidic), epoxides, anhydrides, and acid halides. Flammable gaseous hydrogen may be generated in combination with strong reducing agents, such as hydrides. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | Yellowish liquid Clear, yellowish liquid. |
| Usage: | Dyeing acrylic fibers, chemical intermediate. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
