| Identification | |
| Name: | Benzene,1-ethynyl-4-methoxy- |
| Synonyms: | Anisole,p-ethynyl- (6CI,7CI,8CI);(4-Methoxyphenyl)acetylene;(p-Methoxyphenyl)acetylene;1-Ethynyl-4-methoxybenzene;1-Methoxy-4-ethynylbenzene;4-Methoxy-1-ethynylbenzene;4-Methoxyphenylethyne;Anisylacetylene;NSC 71091;p-Anisylacetylene;p-Anisylethyne;p-Ethynylanisole;p-Methoxyethynylbenzene;p-Methoxyphenylethyne; |
| CAS: | 768-60-5 |
| Molecular Formula: | C9H8O |
| Molecular Weight: | 132.16 |
| InChI: | InChI=1S/C9H8O/c1-3-8-4-6-9(10-2)7-5-8/h1,4-7H,2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1325 |
| Density: | 1.019 |
| Stability: | Light and Temperature Sensitive |
| Refractive index: | 1.563 |
| Appearance: | pale yellow oil |
| Specification: | Pale Yellow Oil usageEng:Intermediate in the synthesis of histamine H3-receptor antagonists. Also utilized to prepare its luminescent copper complex Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Packinggroup: | II |
| Storage Temperature: | Store Cold |
| Sensitive: | Light Sensitive |
| Usage: | Intermediate in the synthesis of histamine H3-receptor antagonists. Also utilized to prepare its luminescent copper complex |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
