Identification |
Name: | 1H-Pyrrole-2,5-dione,1-[4-[7-(diethylamino)-4-methyl-2-oxo-2H-1-benzopyran-3-yl]phenyl]- |
Synonyms: | 7-(Diethylamino)-3-(4'-maleimidylphenyl)-4-methylcoumarin;D 346; |
CAS: | 76877-33-3 |
Molecular Formula: | C24H22N2O4 |
Molecular Weight: | 402.44248 |
InChI: | InChI=1S/C24H22N2O4/c1-4-25(5-2)18-10-11-19-15(3)23(24(29)30-20(19)14-18)16-6-8-17(9-7-16)26-21(27)12-13-22(26)28/h6-14H,4-5H2,1-3H3 |
Molecular Structure: |
 |
Properties |
Density: | 1.302 g/cm3 |
Refractive index: | 1.648 |
Water Solubility: | Soluble in DMSO, DMF, CH3CN and CHCl3 |
Solubility: | Soluble in DMSO, DMF, CH3CN and CHCl3 |
Specification: | usageEng:CPM is probably the most widely used blue fluorescent thiol-reactive dye. This maleimide derivative of coumarin is essentially nonfluorescent until it reacts with thiols, making it possible to quantify thiols without a separation step. CPM is a good energ |
Usage: | CPM is probably the most widely used blue fluorescent thiol-reactive dye. This maleimide derivative of coumarin is essentially nonfluorescent until it reacts with thiols, making it possible to quantify thiols without a separation step. CPM is a good energ |
Safety Data |
|
 |