| Identification | |
| Name: | Nizatidine |
| Synonyms: | Niatidine;Nizatidine (JAN/USP);1,1-Ethenediamine; N-[2-[(dimethylamino) Mythyl]-4- Thiazolyl] Methyl] Ethyl]-Nmethyl-,2-nitro;Naxidine;Tazac;1,1-Ethenediamine, N-(2-(((2-((dimethylamino)methyl)-4-thiazolyl)methyl)thio)ethyl)-N-methyl-2-nitro-;Cronizat;Panaxid;1,1-Ethenediamine,N-[2-[[[2-[(dimethylamino)- methyl]-4-thiazolyl]methyl]thio]ethyl]-N'- methyl-2-nitro-;Nizatidina [Spanish];Antizid;Ulcosol;ZE-101;LY 139037;Axid (TN);Zanizal;1,1-Ethenediamine, N-(2-(((2-((dimethylamino)methyl)-4-thiazoly)methyl)thio)ethyl)-N-methyl-2-nitro-;Calmaxid;Ulxid;Splendil ER;Nizatidinum [Latin];Galitidin;N-(4-(6-Methylamino-7-nitro-2-thia-5-aza-6-hepten-1-yl)-2-thiazolylmethyl)-N,N-dimethylamin;Nizatidine [USAN:BAN:INN:JAN];Distaxid; |
| CAS: | 76963-41-2 |
| Molecular Formula: | C12H21N5O2S2 |
| Molecular Weight: | 331.45744 |
| InChI: | InChI=1S/C12H21N5O2S2/c1-13-11(6-17(18)19)14-4-5-20-8-10-9-21-12(15-10)7-16(2)3/h6,9,13-14H,4-5,7-8H2,1-3H3/b11-6+ |
| Molecular Structure: | ![(C12H21N5O2S2) Niatidine;Nizatidine (JAN/USP);1,1-Ethenediamine; N-[2-[(dimethylamino) Mythyl]-4- Thiazolyl] Methyl...](https://img.guidechem.com/casimg/76963-41-2.gif) |
| Properties | |
| Transport: | OTH |
| Melting Point: | 130-1320C |
| Flash Point: | 243 |
| Boiling Point: | RELATIVE DENSITY |
| Density: | 1.249g/cm3 |
| Refractive index: | 1.592 |
| Water Solubility: | Soluble |
| Solubility: | Soluble |
| Appearance: | white to off-white crystalline powder |
| Specification: | White Crystalline Powder usageEng:Histamine H2-receptor antagonist related to Ranitidine (R120000). Antiulcerative. Safety Statements:36 36:Wear suitable protective clothing |
| Flash Point: | 243 |
| Storage Temperature: | -20?C Freezer |
| Color: | Crystals from ethanol-ethyl acetate Off-white to buff crystalline solid |
| Usage: | Histamine H2-receptor antagonist related to ranitidine |
| Safety Data | |
| Hazard Symbols | |
 |
|
