| Identification | |
| Name: | 1,3-Dibromo-5,5-dimethylhydantoin |
| Synonyms: | 1,3-Dibromo-5,5-dimethyl-2,4-imidazolidinedione; DDH; 1,3-Dibromo-5,5-dimethyldantoin; Bromodan; Dibromantin; DBDMH |
| CAS: | 77-48-5 |
| EINECS: | 201-030-9 |
| Molecular Formula: | C5H6Br2N2O2 |
| Molecular Weight: | 285.92 |
| InChI: | InChI=1/C5H6Br2N2O2/c1-5(2)3(10)8(6)4(11)9(5)7/h1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3087 5.1/PG 2 |
| Density: | 2.183 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.621 |
| Solubility: | Insoluble |
| Appearance: | white powder |
| Specification: |
?1,3-Dibromo-5,5-dimethylhydantoin? , its cas register number is 77-48-5. It also can be called Dibromantin ; Dibromo-5,5-dimethylhydantoin ; 1,3-Dibromo-5,5-dimethyl-2,4-imidazolidinedione ; DBNPA .It is a?white powder. |
| Packinggroup: | II |
| HS Code: | 29332100 |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
