| Identification | |
| Name: | 2,4-Imidazolidinedione,5,5-dimethyl- |
| Synonyms: | Hydantoin,5,5-dimethyl- (6CI,7CI,8CI);4,4-Dimethyl-2,5-dioxoimidazolidine;5,5-Dimethyl-2,4-imidazolidinedione;DM Hydantoin;DMH;Dantoin 736;Dantoin DMH;Dimethylhydantoin;Fennosurf 300;NSC 8652; |
| CAS: | 77-71-4 |
| EINECS: | 201-051-3 |
| Molecular Formula: | C5H8N2O2 |
| Molecular Weight: | 128.13 |
| InChI: | InChI=1/C5H8N2O2/c1-5(2)3(8)6-4(9)7-5/h1-2H3,(H2,6,7,8,9) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Boiling Point: | sublimes |
| Density: | 1.142 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.449 |
| Water Solubility: | soluble |
| Solubility: | soluble in water |
| Appearance: | white to off-white crystals or crystalline powder |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | White, crystalline solid Prisms from dilute alcohol |
| Usage: | Synthesis, preparation of water-soluble polymers. |
| Safety Data | |
 |
|
