| Identification | |
| Name: | 2-Propanol, 1-phenoxy- |
| CAS: | 770-35-4 |
| EINECS: | 212-222-7 |
| Molecular Formula: | C9H12O2 |
| Molecular Weight: | 152.21 |
| InChI: | InChI=1S/C9H12O2/c1-8(10)7-11-9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 11 ºC |
| Boiling Point: | 243 ºC |
| Density: | 1.063 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.521-1.526 |
| Solubility: | 11 g/L |
| Appearance: | green liquid |
| Specification: |
1-Phenoxy-2-propanol ,its cas register number is 770-35-4. It also can be called Propylene glycol phenyl ether ; 1-phenoxypropan-2-ol ; and Propylenephenoxythol . |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Solven in pants, resins, inks, dyes, oiles, cleaners and paints. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
