| Identification | |
| Name: | 1-Adamantanemethanol |
| Synonyms: | Tricyclo(3.3.1.13,7)dec-1-ylmethanol;1-Hydroxymethyl-adamantane;1-Adamantane Methanol; |
| CAS: | 770-71-8 |
| EINECS: | 212-225-3 |
| Molecular Formula: | C11H18O |
| Molecular Weight: | 166.26 |
| InChI: | InChI=1/C11H18O/c12-7-11-4-8-1-9(5-11)3-10(2-8)6-11/h8-10,12H,1-7H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 1.088 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.545 |
| Water Solubility: | Soluble in organic solvents,insoluble in water |
| Appearance: | white crystalline powder |
| Specification: |
? 1-Adamantanemethanol , with CAS number of 770-71-8, can be called Tricyclo(3.3.1.13,7)dec-1-ylmethanol ; 1-Hydroxymethyl-adamantane ; 1-Adamantane Methanol .?It is a white crystalline powder. 1-Adamantanemethanol (CAS NO.770-71-8) should be stored in a cool, dry, well-ventilated area away from incompatible substances. |
| HS Code: | 29061900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
