| Identification | |
| Name: | Benzene,1,2,3-trifluoro-4-nitro- |
| Synonyms: | 2,3,4-Trifluoro-1-nitrobenzene;2,3,4-Trifluoronitrobenzene;4-Nitro-1,2,3-trifluorobenzene;2.3.4-Dichloronitrobenzeme; |
| CAS: | 771-69-7 |
| EINECS: | 212-238-4 |
| Molecular Formula: | C6H2F3NO2 |
| Molecular Weight: | 177.08079 |
| InChI: | InChI=1S/C6H2F3NO2/c7-3-1-2-4(10(11)12)6(9)5(3)8/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 300kgs |
| Density: | 1.541 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.4915-1.4535 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | clear to yellowish liquid |
| Specification: | clear yellow liquid after melting Safety Statements:26-36/37/39-24/25 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 24/25:Avoid contact with skin and eyes |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
