| Identification |
| Name: | Benzene,1-cyclohexen-1-yl- |
| Synonyms: | Cyclohexene,1-phenyl- (3CI);1-Phenylcyclohexene;2-Phenylcyclohexene;Cyclohex-1-en-1-ylbenzene;NSC 403862;NSC 44834; |
| CAS: | 771-98-2 |
| EINECS: | 212-242-6 |
| Molecular Formula: | C12H14 |
| Molecular Weight: | 158.24 |
| InChI: | InChI=1/C12H14/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1,3-4,7-9H,2,5-6,10H2 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.994 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.568-1.57 |
| Solubility: | Insoluble |
| Appearance: | colorless to light yellow liquid |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
F: Flammable
|
| |
 |
