| Identification |
| Name: | pentafluorobenzonitrile |
| Synonyms: | Pentefluorobenzonitrile; Cyanopentafluorobenzene; pentafluoro-benzonitril; Pentafluorocyanobenzene; PERFLUOROBENZONITRILE; 2,3,4,5,6-PENTAFLUORO BENZONITRILE; LABOTEST-BB LT00159675; 2.3.4.5.6-PENTAFLUOROBENZONITRILE 99+%; pentaflurobrombenzene; Pentafluorobenzonitrile99% |
| CAS: | 773-82-0 |
| EINECS: | 212-259-9 |
| Molecular Formula: | C7F5N |
| Molecular Weight: | 193.07 |
| InChI: | InChI=1/C7F5N/c8-3-2(1-13)4(9)6(11)7(12)5(3)10 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1993 |
| Density: | 1.532 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4415-1.4435 |
| Solubility: | Slightly soluble |
| Appearance: | White Crystal |
| Packinggroup: | III |
| HS Code: | 29269095 |
| Storage Temperature: | Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. |
| Safety Data |
| Hazard Symbols |
|
| |
 |
