Identification |
Name: | 4-Nitrobenzyl hydrogen malonate |
Synonyms: | Propanedioicacid, mono[(4-nitrophenyl)methyl] ester (9CI);Malonic acid mono-p-nitrobenzylester;Mono-4-nitrobenzyl malonate;Mono-p-nitrobenzyl malonate;p-Nitrobenzylmalonate; |
CAS: | 77359-11-6 |
Molecular Formula: | C10H9NO6 |
Molecular Weight: | 239.18 |
InChI: | InChI=1/C10H9NO6/c12-9(13)5-10(14)17-6-7-1-3-8(4-2-7)11(15)16/h1-4H,5-6H2,(H,12,13) |
Molecular Structure: |
|
Properties |
Density: | 1.447 g/cm3 |
Refractive index: | 1.579 |
Appearance: | White to Slight yellow Powder |
Specification: |
4-Nitrobenzyl hydrogen malonate , its cas register number is 77359-11-6. It also can be called 3-[(4-Nitrobenzyl)oxy]-3-oxopropanoic acid .
|
Safety Data |
|
|