| Identification |
| Name: | Benzene,2-iodo-1-methyl-4-nitro- |
| Synonyms: | Toluene,2-iodo-4-nitro- (6CI,7CI,8CI); 1-Iodo-2-methyl-5-nitrobenzene;2-Iodo-4-nitrotoluene; NSC 310164 |
| CAS: | 7745-92-8 |
| EINECS: | 231-808-3 |
| Molecular Formula: | C7H6 I N O2 |
| Molecular Weight: | 263.03 |
| InChI: | InChI=1/C7H6INO2/c1-5-2-3-6(9(10)11)4-7(5)8/h2-4H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.883 g/cm3 |
| Stability: | Stable, but light sensitive. Combustible. Incompatible with strong oxidizing agents, strong acids. |
| Water Solubility: | Stability Stable, but light sensitive. Combustible. Incompatible with strong oxidizing agents,strong acids. Toxicology Skin, eye and respiratory irritant. Toxicity data |
| Solubility: | |
| Appearance: | white to light yellow crystal powder |
| Storage Temperature: | Refrigerated. |
| Sensitive: | Light Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
