| Identification | |
| Name: | 3,4-Dimethoxyphenylacetone |
| Synonyms: | 2-Propanone,(3,4-dimethoxyphenyl)- (6CI,7CI);(3,4-Dimethoxyphenyl)acetone;1-(3,4-Dimethoxyphenyl)-2-propanone;3,4-Dimethoxybenzyl methyl ketone;NSC16700; |
| CAS: | 776-99-8 |
| EINECS: | 212-285-0 |
| Molecular Formula: | C11H14O3 |
| Molecular Weight: | 194.23 |
| InChI: | InChI=1/C11H14O3/c1-8(12)6-9-4-5-10(13-2)11(7-9)14-3/h4-5,7H,6H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.115 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5338-1.5358 |
| Appearance: | colorless transparent liquid |
| Specification: |
3,4-Dimethoxyphenylacetone , its cas register number is 776-99-8. It also can be called (3,4-Dimethoxyphenyl)acetone ; 1-(3,4-Dimethoxyphenyl)-2-propanone ; Veratryl-2-propanone ; -(3,4-Dimethoxyphenyl)acetone ; 2-Propanone, 1-(3,4-dimethoxyphenyl)- .It is a clear brown viscous liquid with acetone-like odor. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
