| Identification | |
| Name: | Cyclohexanone,2-methyl-5-(1-methylethenyl)- |
| Synonyms: | Carvone,1,6-dihydro- (5CI); p-Menth-8-en-2-one (7CI,8CI); 1,6-Dihydrocarvone;5-Isopropenyl-2-methylcyclohexanone |
| CAS: | 7764-50-3 |
| EINECS: | 231-857-0 |
| Molecular Formula: | C10H16 O |
| Molecular Weight: | 152.26 |
| InChI: | InChI=1/C10H16O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-9H,1,4-6H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Refractive index: | n20/D 1.472(lit.) |
| Water Solubility: | soluble in alcohol and most fixed oils; insoluble in water |
| Solubility: | soluble in alcohol and most fixed oils; insoluble in water |
| Appearance: | almost colourless liquid with a herbaceous, spearmint-like odour |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
