| Identification | |
| Name: | N-Acetyl-D-mannosamine |
| Synonyms: | beta-D-Mannopyranose, 2-(acetylamino)-2-deoxy-; |
| CAS: | 7772-94-3 |
| Molecular Formula: | C8H15NO6 |
| Molecular Weight: | 221.21 |
| InChI: | InChI=1/C8H15NO6.H2O/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14;/h4-8,10,12-14H,2H2,1H3,(H,9,11);1H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 130ºC |
| Flash Point: | 313.9ºC |
| Boiling Point: | 595.4ºC at 760 mmHg |
| Density: | 1.5 g/cm3 |
| Refractive index: | 1.575 |
| Appearance: | White crystal powder |
| Specification: | Off-White Solid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| HS Code: | 29329985 |
| Flash Point: | 313.9ºC |
| Storage Temperature: | −20°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
