| Identification | |
| Name: | Selenohomocystine |
| Synonyms: | Selenohomocystine;4,4'-Diselenobis(2-aminobutyric acid);BRN 1798698;4,4'-Diselenobis(2-aminobutanoic acid);BUTYRIC ACID, 4,4'-DISELENOBIS(2-AMINO-;AC1L2NH4;LS-47997;Butanoic acid, 4,4'-diselenobis(2-amino-;3-04-00-01656 (Beilstein Handbook Reference);Butanoic acid, 4,4'-diselenobis(2-amino- (9CI);2-amino-4-[(3-amino-4-hydroxy-4-oxobutyl)diselanyl]butanoic acid;7776-33-2 |
| CAS: | 7776-33-2 |
| Molecular Formula: | C8H16N2O4Se2 |
| Molecular Weight: | 362.1436 |
| InChI: | InChI=1/C8H16N2O4Se2/c9-5(7(11)12)1-3-15-16-4-2-6(10)8(13)14/h5-6H,1-4,9-10H2,(H,11,12)(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 299.3°C |
| Boiling Point: | 571.2°C at 760 mmHg |
| Specification: |
Selenohomocystine , its cas register number is 7776-33-2. It also can be called Butanoic acid, 4,4'-diselenobis(2-amino- (9CI) ; and 4,4'-Diselenobis(2-aminobutanoic acid) . |
| Flash Point: | 299.3°C |
| Safety Data | |
 |
|
