| Identification |
| Name: | Oxetane,3,3-bis(chloromethyl)- |
| Synonyms: | 3,3-Bis(chloromethyl)-1-oxacyclobutane;3,3-Bis(chloromethyl)oxacyclobutane;NSC 650608; |
| CAS: | 78-71-7 |
| EINECS: | 201-136-5 |
| Molecular Formula: | C5H8Cl2O |
| Molecular Weight: | 155.03 |
| InChI: | InChI=1/C6H10Cl2O2/c7-4-9-6(10-5-8)2-1-3-6/h1-5H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2810 |
| Density: | 1.236 g/cm3 |
| Refractive index: | n20/D 1.486(lit.) |
| Specification: | Safety Statements:23-26-36/37/39-45 23:Do not breathe gas/fumes/vapor/spray (appropriate wording
to be specified by the manufacturer) 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) |
| Packinggroup: | III |
| Color: | Finely divided powder for coatings Natural, black, or olive green molding powder. |
| Safety Data |
| |
 |