| Identification | |
| Name: | 2-Methyl-1-propanol |
| Synonyms: | Isobutanol; Isobutyl alcohol; Iso-Butanol; Iso Butanol; Natural Isobutyl Alcohol |
| CAS: | 78-83-1 |
| EINECS: | 201-148-0 |
| Molecular Formula: | C4H10O |
| Molecular Weight: | 74.12 |
| InChI: | InChI=1/C4H10O/c1-4(2)3-5/h4-5H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1120/1212 |
| Density: | 0.802 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents, aluminium. |
| Refractive index: | 1.3945-1.3765 |
| Solubility: | 95 g/L (20 oC) in water |
| Appearance: | Colorless liquid and has a characteristic odor |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Color: | Colorless, oily liquid Clear, colorless, refractive, mobile liquid. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
