| Identification | ||
| Name: | 2,3-Dichloro-1-propene | |
| Synonyms: | 2,3-Dichloropropene | |
| CAS: | 78-88-6 | |
| EINECS: | 201-153-8 | |
| Molecular Formula: | C3H4Cl2 | |
| Molecular Weight: | 110.97 | |
| InChI: | InChI=1/C3H4Cl2/c1-3(5)2-4/h1-2H2 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 2047 | |
| Density: | 1.204 | |
| Stability: | Stable under normal temperatures and pressures. | |
| Refractive index: | 1.4601-1.4621 | |
| Water Solubility: | <0.1 g/100 mL at 22 ºC | |
| Solubility: | <0.1 g/100 mL at 22 oC in water | |
| Appearance: | Colorless or light yellow clear liquid | |
| Specification: | clear colorless to pink-brownish liquid Safety Statements:9-16-23-26-36/37/39-61 9:Keep container in a well-ventilated place 16:Keep away from sources of ignition - No smoking 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 61:Avoid release to the environment. Refer to special instructions safety data sheet | |
| Packinggroup: | II | |
| HS Code: | 29032900 | |
| Color: | Straw-colored liquid Colorless to yellow | |
| Safety Data | ||
| Hazard Symbols |
F:Flammable
|
|
 |
||
