| Identification | |
| Name: | Ethanone,1-(9H-fluoren-2-yl)- |
| Synonyms: | Ketone,fluoren-2-yl methyl (6CI,7CI,8CI);1-(9H-Fluoren-2-yl)ethanone;2-Acetyl-9H-fluorene;2-Fluorenyl methylketone;NSC 12351; |
| CAS: | 781-73-7 |
| EINECS: | 212-310-5 |
| Molecular Formula: | C15H12O |
| Molecular Weight: | 208.25 |
| InChI: | InChI=1/C15H12O/c1-10(16)11-6-7-15-13(8-11)9-12-4-2-3-5-14(12)15/h2-8H,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | 381.4 ºC at 760 mmHg |
| Density: | 1.157 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.627 |
| Solubility: | Water Solubility :1 g/L (20 ºC) |
| Appearance: | Slightly yellow solid. |
| Specification: |
Store in a cool, dry place. Keep container closed when not in use.Wash thoroughly after handling. Remove contaminated clothing and wash before reuse. Avoid contact with eyes, skin, and clothing. Avoid ingestion and inhalation. |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data | |
 |
|
