| Identification | |
| Name: | Diclofenac diethylamine |
| Synonyms: | 2-[2-[(2,6-dichlorophenyl)amino]phenyl]acetic acid; N-ethylethanamine;Voltaren Emulgel;2-((2,6-Dichlorophenyl)amino)benzeneacetic acid, compd. with N-ethylethanamine;Benzeneacetic acid, 2-((2,6-dichlorophenyl)amino)-, compd. with N-ethylethanamine (1:1);Benzeneacetic acid,2-[(2,6-dichlorophenyl)- amino]-,compd. with N-ethylethanamine (1:1); |
| CAS: | 78213-16-8 |
| Molecular Formula: | C14H11Cl2NO2.C4H11N |
| Molecular Weight: | 369.28 |
| InChI: | InChI=1/C14H11Cl2NO2.C4H11N/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19;1-3-5-4-2/h1-7,17H,8H2,(H,18,19);5H,3-4H2,1-2H3 |
| Molecular Structure: | ![(C14H11Cl2NO2.C4H11N) 2-[2-[(2,6-dichlorophenyl)amino]phenyl]acetic acid; N-ethylethanamine;Voltaren Emulgel;2-((2,6-Dichl...](https://img.guidechem.com/casimg/78213-16-8.gif) |
| Properties | |
| Flash Point: | 203°C |
| Boiling Point: | 412°C at 760 mmHg |
| Flash Point: | 203°C |
| Safety Data | |
 |
|
