| Identification | |
| Name: | Loxacor-d4 |
| Synonyms: | 2-[1-(2,6-Dichlorophenoxy)ethyl]-4,5-dihydro-1H-imidazole-d4;Ba-168-d4;Britlofex-d4;Lofetensin-d4;Lofexidine-d4;Loxacor-d4;MDL-14042A-d4 |
| CAS: | 78302-26-8 |
| Molecular Formula: | C11H8D4Cl2N2O |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C11H12Cl2N2O/c1-7(11-14-5-6-15-11)16-10-8(12)3-2-4-9(10)13/h2-4,7H,5-6H2,1H3,(H,14,15)/i5D2,6D2 |
| Molecular Structure: | ![(C11H8D4Cl2N2O) 2-[1-(2,6-Dichlorophenoxy)ethyl]-4,5-dihydro-1H-imidazole-d4;Ba-168-d4;Britlofex-d4;Lofetensin-d4;Lo...](https://img1.guidechem.com/chem/e/dict/140/78302-26-8.jpg) |
| Properties | |
| Melting Point: | 229-231?C |
| Flash Point: | 208.726°C |
| Boiling Point: | 421.517°C at 760 mmHg |
| Density: | 1.412g/cm3 |
| Refractive index: | 1.611 |
| Specification: | Off-White Solid usageEng:a2-Adrenoceptor agonist related structurally to Clonidine. Used in treatment of opioid withdrawal symptoms; antihypertensive. |
| Flash Point: | 208.726°C |
| Usage: | a2-Adrenoceptor agonist related structurally to Clonidine. Used in treatment of opioid withdrawal symptoms; antihypertensive. |
| Safety Data | |
 |
|
