| Identification | |
| Name: | 9-Fluorenone-2-carboxylic acid |
| Synonyms: | 9-Oxo-2-fluorenecarboxylic acid; 9-Fluorenon-2-carboxylic acid |
| CAS: | 784-50-9 |
| EINECS: | 212-317-3 |
| Molecular Formula: | C14H8O3 |
| Molecular Weight: | 224.21 |
| InChI: | InChI=1/C14H8O3/c15-13-11-4-2-1-3-9(11)10-6-5-8(14(16)17)7-12(10)13/h1-7H,(H,16,17) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.424 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Soluble |
| Appearance: | yellow powder. |
| Specification: | yellow fine powder Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
