| Identification |
| Name: | 9H-Pyrido[3,4-b]indole-3-carboxamide,N-methyl- |
| Synonyms: | FG 7142;LSU 65; N-Methyl-b-carboline-3-carboxamide;ZK 39106 |
| CAS: | 78538-74-6 |
| Molecular Formula: | C13H11 N3 O |
| Molecular Weight: | 225.27 |
| InChI: | InChI=1/C13H11N3O/c1-14-13(17)11-6-9-8-4-2-3-5-10(8)16-12(9)7-15-11/h2-7,16H,1H3,(H,14,17) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 302.3°C |
| Boiling Point: | 576.3°C at 760 mmHg |
| Density: | 1.328g/cm3 |
| Refractive index: | 1.735 |
| Biological Activity: | Inverse agonist and anxiogenic agent. Increases tyrosine hydroxylation and causes upregulation of β -adrenoceptors in mouse cerebral cortex. |
| Flash Point: | 302.3°C |
| Storage Temperature: | 2-8°C |
| Color: | light tan |
| Safety Data |
| |
 |
