| Identification |
| Name: | Hexythiazox |
| Synonyms: | 3-Thiazolidinecarboxamide, 5-(4-chlorophenyl)-N-cyclohexyl-4-methyl-2-oxo-, (4R,5R)-rel-;3-Thiazolidinecarboxamide, 5-(4-chlorophenyl)-N-cyclohexyl-4-methyl-2-oxo-, trans-;Hexythiazox [BSI:ISO];(4RS,5RS)-5-(4-Chlorophenyl)-N-cyclohexyl-4-methyl-2-oxo-1,3-thiazolidine-3-carboxamide;Acarflor;Acariflor;Calibre;Cesar;DPX Y5893-9;HSDB 6671; |
| CAS: | 78587-05-0 |
| Molecular Formula: | C17H21ClN2O2S |
| Molecular Weight: | 352.88 |
| InChI: | InChI=1/C17H21ClN2O2S/c1-11-15(12-7-9-13(18)10-8-12)23-17(22)20(11)16(21)19-14-5-3-2-4-6-14/h7-11,14-15H,2-6H2,1H3,(H,19,21)/t11-,15+/m0/s1 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3077 |
| Density: | 1.31 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.621 |
| Water Solubility: | 0.5mg/L |
| Solubility: | 0.5 mg/L (20 C) |
| Appearance: | light tan granules with a faint ligneous odor |
| Color: | White crystals Colorless crystals |
| Usage: | Acaricide. |
| Safety Data |
| Hazard Symbols |
N:Dangerousfortheenvironment
|
| |
 |