| Identification | |
| Name: | 3-Pyridinamine,2,5-dichloro- |
| Synonyms: | 3-Amino-2,5-dichloropyridine;2,5-Dichloropyridin-3-ylamine; |
| CAS: | 78607-32-6 |
| Molecular Formula: | C5H4Cl2N2 |
| Molecular Weight: | 163.00 |
| InChI: | InChI=1/C5H4Cl2N2/c6-3-1-4(8)5(7)9-2-3/h1-2H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Melting Point: | 124-125 oC |
| Density: | 1.498g/cm3 |
| Refractive index: | 1.623 |
| Specification: | Off-White to Pale Beige Solid Safety Statements:26-36/37/39-37/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Storage Temperature: | Refrigerator |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
