| Identification |
| Name: | 3,5-dimethylbenzylamine |
| Synonyms: | (3,5-Dimethylphenyl)methanamine;3,5-Dimethylbenzenemethanamine; 3,5-Dimethylbenzylamine |
| CAS: | 78710-55-1 |
| EINECS: | 278-974-3 |
| Molecular Formula: | C9H13N |
| Molecular Weight: | 135.21 |
| InChI: | InChI=1/C9H13N/c1-7-3-8(2)5-9(4-7)6-10/h3-5H,6,10H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.952 g/cm3 |
| Refractive index: | 1.537 |
| Appearance: | Colorless to yellow clear liquid |
| Safety Data |
| |
 |