| Identification | |
| Name: | 1,2,3-Thiadiazole-5-carboxylicacid, 4-phenyl- |
| Synonyms: | 4-Phenyl[1,2,3]thiadiazole-5-carboxylicacid |
| CAS: | 78875-63-5 |
| Molecular Formula: | C9H6 N2 O2 S |
| Molecular Weight: | 206.22 |
| InChI: | InChI=1/C9H6N2O2S/c12-9(13)8-7(10-11-14-8)6-4-2-1-3-5-6/h1-5H,(H,12,13) |
| Molecular Structure: | ![(C9H6N2O2S) 4-Phenyl[1,2,3]thiadiazole-5-carboxylicacid](https://img1.guidechem.com/chem/e/dict/19/78875-63-5.jpg) |
| Properties | |
| Flash Point: | 183.6°C |
| Boiling Point: | 380°C at 760 mmHg |
| Density: | 1.44g/cm3 |
| Refractive index: | 1.651 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 183.6°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
