| Identification | |
| Name: | Trichloroethylene |
| Synonyms: | 1-chloro-2,2-dichloroethylene; 1,1-dichloro-2-chloroethylene; 1,2,2-trichloroethylene; anamenth; benzinol; blacosolv; blancosolv; cecolene; chlorilen; chlorylea; chorylen; circosolv; crawhaspol; densinfluat; dow-tri; dukeron; fleck-flip; flock flip; fluate; lanadin; lethurin; narcogen; narkogen; narkosoid; Nialk; perm-a-chlor; perm-a-clor; petzinol; philex; threthylene; Triad; Trial; triasol; triklone; Triol; tri-plus; tri-plus m; vestrol; vitran; trieline; 1,1,2-trichloroethene; Acetylene trichloride; Ethinyl trichloride; ethylene trichloride; triciene; 1,1,2-Trichloroethylene; Tri; TCE; trichloroethene; Westrosol; Chlorylen; Gemalgene; Germalgene; Tri-Clene; Trielene; Trilene; Trichloran; Trichloren; Algylen; Trimar; Triline; Trethylene; Trichlorathane; Trichloroethylene (TCE) |
| CAS: | 79-01-6 |
| EINECS: | 201-167-4 |
| Molecular Formula: | C2HCl3 |
| Molecular Weight: | 131.39 |
| InChI: | InChI=1/C2HCl3/c3-1-2(4)5/h1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1710 |
| Density: | 1.462 |
| Stability: | Stable. Incompatible with oxidizing agents, aluminium, magnesium, strong bases, reducing agents. Light-sensitive. Reacts violently with many metals, ozone, potassium nitrate, potassium hydroxide, sodium hydroxide. |
| Refractive index: | 1.476-1.478 |
| Water Solubility: | Slightly soluble. 0.11 g/100 mL |
| Solubility: | Slightly soluble in water. 0.11 g/100 mL |
| Appearance: | colorless transparent flow liquid, with chloroform-like odor. |
| Packinggroup: | III |
| HS Code: | 29032200 |
| Color: | CLEAR, COLORLESS, OR BLUE MOBILE LIQUID Colorless liquid (unless dyed blue). |
| Usage: | Therap cat: anesthetic (inhalation)former use, therap cat (vet): anesthetic (inhalation). |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
