| Identification | |
| Name: | Acrylic acid |
| Synonyms: | acrylic acid anhydrous; Acrylic Acid, Polymer Grade; Propenoic acid; AA |
| CAS: | 79-10-7 |
| EINECS: | 201-177-9 |
| Molecular Formula: | C3H4O2 |
| Molecular Weight: | 72.06 |
| InChI: | InChI=1/C3H4O2/c1-2-3(4)5/h2H,1H2,(H,4,5) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2218 |
| Density: | 1.051 |
| Stability: | Stability Unstable - may contain p-methoxyphenol as an inhibitor. Prone to hazardous polymerization. Combustible. Incompatible with strong oxidizing agents, strong bases, amines. Contact with oxidizers may cause fire. Light and air sensitive. Hygroscopic. |
| Refractive index: | 1.4192-1.4212 |
| Water Solubility: | MISCIBLE |
| Solubility: | Miscible with water |
| Appearance: | Colorless liquid |
| Packinggroup: | II |
| HS Code: | 29161110 |
| Sensitive: | Air Sensitive |
| Color: | Volatile liquid Colorless liquid Colorless liquid or solid (below 55 degrees F) |
| Usage: | Chemical intermediate for ethyl acrylate, n-butyl acrylate, methyl acrylate, 2-ethylhexyl acrylate, for other specialty acrylates, eg, hydroxyethyl, monomer for polyacrylic acid & salts, eg, thickeners, comonomer with acrylamide for polymers used as flocculants, with ethylene for ion exchange resin polymers, with methyl ester for polymers, eg, thickeners, for other copolymers, eg, with itatonic acid. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
