| Identification | |
| Name: | Glycolic acid |
| Synonyms: | Hydroxyacetic acid; Glycolic acid solution; glycollic acid; Hydroxyethanoic acid |
| CAS: | 79-14-1 |
| EINECS: | 201-180-5 |
| Molecular Formula: | C2H4O3 |
| Molecular Weight: | 76.05 |
| InChI: | InChI=1/C2H4O3/c3-1-2(4)5/h3H,1H2,(H,4,5) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 8/PG 3 |
| Density: | 1.27 |
| Stability: | Stable. Incompatible with bases, oxidizing agents and reducing agents. |
| Refractive index: | n20/D 1.424 |
| Water Solubility: | SOLUBLE |
| Solubility: | H2O: 0.1 g/mL, clear |
| Appearance: | Light yellow to amber liquid |
| Specification: |
?Glycolic acid , its CAS NO. is 79-14-1, the synonyms are 2-Hydroxyacetic acid ; Acetic acid, hydroxy- ; EPA Pesticide Chemical Code 000101 ; Glycollic acid ; Hydroxyacetic acid ; Hydroxyethanoic acid ; Kyselina glykolova ; Kyselina hydroxyoctova . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Sensitive: | Hygroscopic |
| Color: | Colorless, translucent solid Solid glycolic acid forms colorless, monoclinic, prismatic crystals. Orthorhombic needles from water; leaves from diethyl ether |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
