| Identification |
| Name: | N-Methylacetamide |
| Synonyms: | N-Methylacetamide,(N-Acetylmethylamine); N-Acetylmethylamine; ACETYL METHYLAMIDE; ACETYLMETHYLAMINE; ACETMETHYLAMIDE; ACETIC ACID METHYLAMIDE; LABOTEST-BB LT00779190; dimethylcarboxamide; NMA; N-ACETYL-N-METHYLAMINE; Acetamide,N-methyl-; aceticacid,amide,n-methyl; Acetylmethylammine; CH3CONHCH3; methyl-acetamid; N-MethylAcetylamide |
| CAS: | 79-16-3 |
| EINECS: | 201-182-6 |
| Molecular Formula: | C3H7NO |
| Molecular Weight: | 73.09 |
| InChI: | InChI=1/C3H7NO/c1-3(5)4-2/h1-2H3,(H,4,5) |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.946 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.432-1.434 |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | colourless liquid or solid |
| Specification: |
N-Methylacetamide (CAS NO.79-16-3) is also named as AI3-18019 ; Acetamide, N-methyl- ; Acetamide, methyl- ; Acetic acid, amide, N-methyl ; HSDB 94 ; Methylacetamide ; Monomethylacetamide ; N-Methylacetamide ; N-Monomethylacetamide ; NSC 747 ; X 44 . N-Methylacetamide (CAS NO.79-16-3) is colourless liquid or solid. It is stable and combustible but incompatible with strong oxidizing agents. It is toxic. It is flammable. It will produce toxic nitrogen oxide fumes when buring. So the storage environment should be ventilate, low-temperature and dry.
|
| Report: |
Reported in EPA TSCA Inventory.
|
| HS Code: | 29241900 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Color: | NEEDLES |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |