| Identification |
| Name: | Isobutyryl chloride |
| Synonyms: | 2-Methylpropanoyl chloride; isobutyrl chloride; ISOBUTYROYL CHLORIDE (IBCL) |
| CAS: | 79-30-1 |
| EINECS: | 201-194-1 |
| Molecular Formula: | C4H7ClO |
| Molecular Weight: | 106.55 |
| InChI: | InChI=1/C4H7ClO/c1-3(2)4(5)6/h3H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2395 |
| Density: | 1.017 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.406-1.408 |
| Water Solubility: | Reacts |
| Solubility: | Rapidly hydrolysis |
| Appearance: | Clear liquid |
| Packinggroup: | II |
| HS Code: | 29147090 |
| Storage Temperature: | Store at RT. |
| Sensitive: | Moisture Sensitive |
| Usage: | In manufacture of chloranil electrodes for ph measurements, to manufacture compound used in dye industry, as reagent for pamaquine (plasmochin) in urine (blue color). Fungicide. |
| Safety Data |
| Hazard Symbols |
F:Flammable
T:Toxic
|
| |
 |
