| Identification | |
| Name: | 2-Mercaptopropionic acid |
| Synonyms: | Thiolacticacid,95%; Thiolactic acid; 2-Mercaptopropanic Acid; 2-Mercapto Propionic Acid |
| CAS: | 79-42-5 |
| EINECS: | 201-206-5 |
| Molecular Formula: | C3H6O2S |
| Molecular Weight: | 106.14 |
| InChI: | InChI=1/C3H6O2S/c1-2(6)3(4)5/h2,6H,1H3,(H,4,5) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2936 |
| Density: | 1.197 |
| Stability: | Has not been fully evaluated. |
| Refractive index: | 1.4804-1.4824 |
| Water Solubility: | MISCIBLE |
| Solubility: | MISCIBLE in water |
| Appearance: | Clear colorless to slightly yellow liquid |
| Specification: |
2-Thiolactic acid (CAS NO.79-42-5), its Synonyms are 2-Mercaptopropanoic acid ; 2-Mercaptopropionic acid ; Propanoic acid, 2-mercapto- ; Propionic acid, 2-mercapto- ; Thiolactic acid ; alpha-Mercaptopropanoic acid ; alpha-Mercaptopropionic acid ; 2-Thiolpropionic acid . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| HS Code: | 29309070 |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. Corrosives area. |
| Usage: | Substance is used in depilatory and hair waving prepns. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
