| Identification | |
| Name: | Benzothiazole,2-chloro-6-ethoxy- |
| Synonyms: | 2-Chloro-6-ethoxy-1,3-benzothiazole;2-Chloro-6-ethoxybenzothiazole; NSC 503417 |
| CAS: | 79071-17-3 |
| Molecular Formula: | C9H8 Cl N O S |
| Molecular Weight: | 213.68 |
| InChI: | InChI=1/C9H8ClNOS/c1-2-12-6-3-4-7-8(5-6)13-9(10)11-7/h3-5H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 139.6°C |
| Boiling Point: | 307.2°C at 760 mmHg |
| Density: | 1.346g/cm3 |
| Refractive index: | 1.634 |
| Specification: |
The 2-Chloro-6-ethoxybenzothiazole with the CAS number 79071-17-3 is also called Benzothiazole,2-chloro-6-ethoxy-. Both the systematic name and IUPAC name are 2-chloro-6-ethoxy-1,3-benzothiazole. Its molecular formula is C9H8ClNOS. The product category is Benzothiazole. The properties of the 2-Chloro-6-ethoxybenzothiazole are: (1)ACD/LogP: 3.86; (2)# of Rule of 5 Violations: 0 ; (3)#H bond acceptors: 2; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 50.36 Å2; (7)Index of Refraction: 1.634; (8)Molar Refractivity: 56.77 cm3; (9)Molar Volume: 158.7 cm3; (10)Polarizability: 22.5×10-24cm3; (11)Surface Tension: 49.3 dyne/cm; (12)Enthalpy of Vaporization: 52.6 kJ/mol; (13)Vapour Pressure: 0.00133 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 139.6°C |
| Safety Data | |
 |
|
